C21H25ClN6 — CID 134251358
5-chloro-2-[(1-cyclopropyl-2H-imidazo[4,5-c]pyridin-3-yl)methyl]-1-(3-methylbutyl)imidazo[4,5-b]pyridine (PubChem CID 134251358) has the molecular formula C21H25ClN6 and a molecular weight of 396.93 g/mol. Its IUPAC name is 5-chloro-2-[(1-cyclopropyl-2H-imidazo[4,5-c]pyridin-3-yl)methyl]-1-(3-methylbutyl)imidazo[4,5-b]pyridine.
| Compound Name | 5-chloro-2-[(1-cyclopropyl-2H-imidazo[4,5-c]pyridin-3-yl)methyl]-1-(3-methylbutyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 134251358 |
| Molecular Formula | C21H25ClN6 |
| Molecular Weight | 396.93 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 5-chloro-2-[(1-cyclopropyl-2H-imidazo[4,5-c]pyridin-3-yl)methyl]-1-(3-methylbutyl)imidazo[4,5-b]pyridine |
| SMILES | CC(C)CCn1c(CN2CN(C3CC3)c3ccncc32)nc2nc(Cl)ccc21 |
| InChI | InChI=1S/C21H25ClN6/c1-14(2)8-10-27-17-5-6-19(22)24-21(17)25-20(27)12-26-13-28(15-3-4-15)16-7-9-23-11-18(16)26/h5-7,9,11,14-15H,3-4,8,10,12-13H2,1-2H3 |
| InChIKey | IREJEEOCTUDJQA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.93 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|