C16H17N3O2 — CID 134252734
(Z)-3-(1H-indol-7-ylmethylamino)-2-[(Z)-2-(methylideneamino)ethenyl]but-2-enoic acid (PubChem CID 134252734) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is (Z)-3-(1H-indol-7-ylmethylamino)-2-[(Z)-2-(methylideneamino)ethenyl]but-2-enoic acid.
| Compound Name | (Z)-3-(1H-indol-7-ylmethylamino)-2-[(Z)-2-(methylideneamino)ethenyl]but-2-enoic acid |
|---|---|
| PubChem CID | 134252734 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | (Z)-3-(1H-indol-7-ylmethylamino)-2-[(Z)-2-(methylideneamino)ethenyl]but-2-enoic acid |
| SMILES | C=N/C=C\C(C(=O)O)=C(/C)NCc1cccc2cc[nH]c12 |
| InChI | InChI=1S/C16H17N3O2/c1-11(14(16(20)21)7-8-17-2)19-10-13-5-3-4-12-6-9-18-15(12)13/h3-9,18-19H,2,10H2,1H3,(H,20,21)/b8-7-,14-11- |
| InChIKey | SWRWXUULIUUBAB-OOKLLDCXSA-N |
| XLogP | 2.83 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|