C17H19FN2O — CID 134252909
(3R)-4-[4-(6-fluoro-3-pyridinyl)-3-methylphenyl]-3-methylmorpholine (PubChem CID 134252909) has the molecular formula C17H19FN2O and a molecular weight of 286.35 g/mol. Its IUPAC name is (3R)-4-[4-(6-fluoro-3-pyridinyl)-3-methylphenyl]-3-methylmorpholine.
| Compound Name | (3R)-4-[4-(6-fluoro-3-pyridinyl)-3-methylphenyl]-3-methylmorpholine |
|---|---|
| PubChem CID | 134252909 |
| Molecular Formula | C17H19FN2O |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | (3R)-4-[4-(6-fluoro-3-pyridinyl)-3-methylphenyl]-3-methylmorpholine |
| SMILES | Cc1cc(N2CCOC[C@H]2C)ccc1-c1ccc(F)nc1 |
| InChI | InChI=1S/C17H19FN2O/c1-12-9-15(20-7-8-21-11-13(20)2)4-5-16(12)14-3-6-17(18)19-10-14/h3-6,9-10,13H,7-8,11H2,1-2H3/t13-/m1/s1 |
| InChIKey | DPBZINDTOIQSBF-CYBMUJFWSA-N |
| XLogP | 3.42 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|