C19H24N2O3S — CID 158073467
2-[5-[2-methyl-4-[(3S)-3-methylmorpholin-4-yl]phenyl]-2-pyridinyl]acetic acid;sulfane (PubChem CID 158073467) has the molecular formula C19H24N2O3S and a molecular weight of 360.48 g/mol. Its IUPAC name is 2-[5-[2-methyl-4-[(3S)-3-methylmorpholin-4-yl]phenyl]-2-pyridinyl]acetic acid;sulfane.
| Compound Name | 2-[5-[2-methyl-4-[(3S)-3-methylmorpholin-4-yl]phenyl]-2-pyridinyl]acetic acid;sulfane |
|---|---|
| PubChem CID | 158073467 |
| Molecular Formula | C19H24N2O3S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 2-[5-[2-methyl-4-[(3S)-3-methylmorpholin-4-yl]phenyl]-2-pyridinyl]acetic acid;sulfane |
| SMILES | Cc1cc(N2CCOC[C@@H]2C)ccc1-c1ccc(CC(=O)O)nc1.S |
| InChI | InChI=1S/C19H22N2O3.H2S/c1-13-9-17(21-7-8-24-12-14(21)2)5-6-18(13)15-3-4-16(20-11-15)10-19(22)23;/h3-6,9,11,14H,7-8,10,12H2,1-2H3,(H,22,23);1H2/t14-;/m0./s1 |
| InChIKey | FMBZKHULXYUZOQ-UQKRIMTDSA-N |
| XLogP | 3.02 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |