C26H45O8P — CID 134253548
phosphonooxymethyl 4-(7-hydroxy-3-methoxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoate (PubChem CID 134253548) has the molecular formula C26H45O8P and a molecular weight of 516.61 g/mol. Its IUPAC name is phosphonooxymethyl 4-(7-hydroxy-3-methoxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoate.
| Compound Name | phosphonooxymethyl 4-(7-hydroxy-3-methoxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoate |
|---|---|
| PubChem CID | 134253548 |
| Molecular Formula | C26H45O8P |
| Molecular Weight | 516.61 g/mol |
| Exact Mass | 516.29 |
| IUPAC Name | phosphonooxymethyl 4-(7-hydroxy-3-methoxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoate |
| SMILES | COC1CCC2(C)C(C1)CC(O)C1C2CCC2(C)C(C(C)CCC(=O)OCOP(=O)(O)O)CCC12 |
| InChI | InChI=1S/C26H45O8P/c1-16(5-8-23(28)33-15-34-35(29,30)31)19-6-7-20-24-21(10-12-26(19,20)3)25(2)11-9-18(32-4)13-17(25)14-22(24)27/h16-22,24,27H,5-15H2,1-4H3,(H2,29,30,31) |
| InChIKey | XUKORPYXIDUZMQ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.61 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|