C24H38F2O2 — CID 134253670
4-(3,3-difluoro-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)pentanoic acid (PubChem CID 134253670) has the molecular formula C24H38F2O2 and a molecular weight of 396.56 g/mol. Its IUPAC name is 4-(3,3-difluoro-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)pentanoic acid.
| Compound Name | 4-(3,3-difluoro-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)pentanoic acid |
|---|---|
| PubChem CID | 134253670 |
| Molecular Formula | C24H38F2O2 |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.28 |
| IUPAC Name | 4-(3,3-difluoro-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)pentanoic acid |
| SMILES | CC(CCC(=O)O)C1CCC2C3CCC4CC(F)(F)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C24H38F2O2/c1-15(4-9-21(27)28)18-7-8-19-17-6-5-16-14-24(25,26)13-12-22(16,2)20(17)10-11-23(18,19)3/h15-20H,4-14H2,1-3H3,(H,27,28) |
| InChIKey | LJHBMSCRCXTPDO-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |