C23H35FN4O3 — CID 134256180
2-amino-N-[[4-fluoro-1-[(4-hydroxyoxan-4-yl)methyl]piperidin-4-yl]methyl]-3-(propan-2-yliminomethyl)benzamide (PubChem CID 134256180) has the molecular formula C23H35FN4O3 and a molecular weight of 434.56 g/mol. Its IUPAC name is 2-amino-N-[[4-fluoro-1-[(4-hydroxyoxan-4-yl)methyl]piperidin-4-yl]methyl]-3-(propan-2-yliminomethyl)benzamide.
| Compound Name | 2-amino-N-[[4-fluoro-1-[(4-hydroxyoxan-4-yl)methyl]piperidin-4-yl]methyl]-3-(propan-2-yliminomethyl)benzamide |
|---|---|
| PubChem CID | 134256180 |
| Molecular Formula | C23H35FN4O3 |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | 2-amino-N-[[4-fluoro-1-[(4-hydroxyoxan-4-yl)methyl]piperidin-4-yl]methyl]-3-(propan-2-yliminomethyl)benzamide |
| SMILES | CC(C)/N=C/c1cccc(C(=O)NCC2(F)CCN(CC3(O)CCOCC3)CC2)c1N |
| InChI | InChI=1S/C23H35FN4O3/c1-17(2)26-14-18-4-3-5-19(20(18)25)21(29)27-15-22(24)6-10-28(11-7-22)16-23(30)8-12-31-13-9-23/h3-5,14,17,30H,6-13,15-16,25H2,1-2H3,(H,27,29)/b26-14+ |
| InChIKey | GZAKPOOWNBOREB-VULFUBBASA-N |
| XLogP | 2.17 |
| TPSA | 100.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|