C22H28ClFN4O2 — CID 86272361
5-amino-6-chloro-N-[[4-fluoro-1-(oxan-4-ylmethyl)piperidin-4-yl]methyl]quinoline-8-carboxamide (PubChem CID 86272361) has the molecular formula C22H28ClFN4O2 and a molecular weight of 434.94 g/mol. Its IUPAC name is 5-amino-6-chloro-N-[[4-fluoro-1-(oxan-4-ylmethyl)piperidin-4-yl]methyl]quinoline-8-carboxamide.
| Compound Name | 5-amino-6-chloro-N-[[4-fluoro-1-(oxan-4-ylmethyl)piperidin-4-yl]methyl]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 86272361 |
| Molecular Formula | C22H28ClFN4O2 |
| Molecular Weight | 434.94 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 5-amino-6-chloro-N-[[4-fluoro-1-(oxan-4-ylmethyl)piperidin-4-yl]methyl]quinoline-8-carboxamide |
| SMILES | Nc1c(Cl)cc(C(=O)NCC2(F)CCN(CC3CCOCC3)CC2)c2ncccc12 |
| InChI | InChI=1S/C22H28ClFN4O2/c23-18-12-17(20-16(19(18)25)2-1-7-26-20)21(29)27-14-22(24)5-8-28(9-6-22)13-15-3-10-30-11-4-15/h1-2,7,12,15H,3-6,8-11,13-14,25H2,(H,27,29) |
| InChIKey | IRZKIFRMYNFBFQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.94 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|