C21H26ClF2N3O — CID 158008647
1-(5-amino-6-chloroquinolin-8-yl)-3-[4-fluoro-1-(2-fluoro-2-methylpropyl)piperidin-4-yl]propan-1-one (PubChem CID 158008647) has the molecular formula C21H26ClF2N3O and a molecular weight of 409.91 g/mol. Its IUPAC name is 1-(5-amino-6-chloroquinolin-8-yl)-3-[4-fluoro-1-(2-fluoro-2-methylpropyl)piperidin-4-yl]propan-1-one.
| Compound Name | 1-(5-amino-6-chloroquinolin-8-yl)-3-[4-fluoro-1-(2-fluoro-2-methylpropyl)piperidin-4-yl]propan-1-one |
|---|---|
| PubChem CID | 158008647 |
| Molecular Formula | C21H26ClF2N3O |
| Molecular Weight | 409.91 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 1-(5-amino-6-chloroquinolin-8-yl)-3-[4-fluoro-1-(2-fluoro-2-methylpropyl)piperidin-4-yl]propan-1-one |
| SMILES | CC(C)(F)CN1CCC(F)(CCC(=O)c2cc(Cl)c(N)c3cccnc23)CC1 |
| InChI | InChI=1S/C21H26ClF2N3O/c1-20(2,23)13-27-10-7-21(24,8-11-27)6-5-17(28)15-12-16(22)18(25)14-4-3-9-26-19(14)15/h3-4,9,12H,5-8,10-11,13,25H2,1-2H3 |
| InChIKey | FEPPBZVDDBKOHS-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.91 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|