C20H26ClFN4O2 — CID 90459149
5-amino-6-chloro-N-[[4-(3-fluoro-2-hydroxy-2-methylpropyl)piperidin-4-yl]methyl]quinoline-8-carboxamide (PubChem CID 90459149) has the molecular formula C20H26ClFN4O2 and a molecular weight of 408.91 g/mol. Its IUPAC name is 5-amino-6-chloro-N-[[4-(3-fluoro-2-hydroxy-2-methylpropyl)piperidin-4-yl]methyl]quinoline-8-carboxamide.
| Compound Name | 5-amino-6-chloro-N-[[4-(3-fluoro-2-hydroxy-2-methylpropyl)piperidin-4-yl]methyl]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 90459149 |
| Molecular Formula | C20H26ClFN4O2 |
| Molecular Weight | 408.91 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 5-amino-6-chloro-N-[[4-(3-fluoro-2-hydroxy-2-methylpropyl)piperidin-4-yl]methyl]quinoline-8-carboxamide |
| SMILES | CC(O)(CF)CC1(CNC(=O)c2cc(Cl)c(N)c3cccnc23)CCNCC1 |
| InChI | InChI=1S/C20H26ClFN4O2/c1-19(28,11-22)10-20(4-7-24-8-5-20)12-26-18(27)14-9-15(21)16(23)13-3-2-6-25-17(13)14/h2-3,6,9,24,28H,4-5,7-8,10-12,23H2,1H3,(H,26,27) |
| InChIKey | SPIBLAZSTIHUDJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.91 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|