C19H25Cl2N3O3 — CID 23627252
4-amino-5-chloro-N-[1-(oxolan-3-ylmethyl)piperidin-4-yl]-1-benzofuran-7-carboxamide;hydrochloride (PubChem CID 23627252) has the molecular formula C19H25Cl2N3O3 and a molecular weight of 414.33 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[1-(oxolan-3-ylmethyl)piperidin-4-yl]-1-benzofuran-7-carboxamide;hydrochloride.
| Compound Name | 4-amino-5-chloro-N-[1-(oxolan-3-ylmethyl)piperidin-4-yl]-1-benzofuran-7-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 23627252 |
| Molecular Formula | C19H25Cl2N3O3 |
| Molecular Weight | 414.33 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 4-amino-5-chloro-N-[1-(oxolan-3-ylmethyl)piperidin-4-yl]-1-benzofuran-7-carboxamide;hydrochloride |
| SMILES | Cl.Nc1c(Cl)cc(C(=O)NC2CCN(CC3CCOC3)CC2)c2occc12 |
| InChI | InChI=1S/C19H24ClN3O3.ClH/c20-16-9-15(18-14(17(16)21)4-8-26-18)19(24)22-13-1-5-23(6-2-13)10-12-3-7-25-11-12;/h4,8-9,12-13H,1-3,5-7,10-11,21H2,(H,22,24);1H |
| InChIKey | FQEUXMPMTFMQLY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|