C20H26ClN3O4 — CID 69401231
2-methylpropyl 4-[[(4-amino-5-chloro-1-benzofuran-7-carbonyl)amino]methyl]piperidine-1-carboxylate (PubChem CID 69401231) has the molecular formula C20H26ClN3O4 and a molecular weight of 407.90 g/mol. Its IUPAC name is 2-methylpropyl 4-[[(4-amino-5-chloro-1-benzofuran-7-carbonyl)amino]methyl]piperidine-1-carboxylate.
| Compound Name | 2-methylpropyl 4-[[(4-amino-5-chloro-1-benzofuran-7-carbonyl)amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 69401231 |
| Molecular Formula | C20H26ClN3O4 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 2-methylpropyl 4-[[(4-amino-5-chloro-1-benzofuran-7-carbonyl)amino]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)COC(=O)N1CCC(CNC(=O)c2cc(Cl)c(N)c3ccoc23)CC1 |
| InChI | InChI=1S/C20H26ClN3O4/c1-12(2)11-28-20(26)24-6-3-13(4-7-24)10-23-19(25)15-9-16(21)17(22)14-5-8-27-18(14)15/h5,8-9,12-13H,3-4,6-7,10-11,22H2,1-2H3,(H,23,25) |
| InChIKey | UBWQPEJSWHXKMG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|