C20H24ClN3O3 — CID 122455043
4-amino-5-chloro-N-[[3-(oxan-4-yl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]-1-benzofuran-7-carboxamide (PubChem CID 122455043) has the molecular formula C20H24ClN3O3 and a molecular weight of 389.88 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[[3-(oxan-4-yl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]-1-benzofuran-7-carboxamide.
| Compound Name | 4-amino-5-chloro-N-[[3-(oxan-4-yl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]-1-benzofuran-7-carboxamide |
|---|---|
| PubChem CID | 122455043 |
| Molecular Formula | C20H24ClN3O3 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 4-amino-5-chloro-N-[[3-(oxan-4-yl)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]-1-benzofuran-7-carboxamide |
| SMILES | Nc1c(Cl)cc(C(=O)NCC2C3CN(C4CCOCC4)CC23)c2occc12 |
| InChI | InChI=1S/C20H24ClN3O3/c21-17-7-13(19-12(18(17)22)3-6-27-19)20(25)23-8-14-15-9-24(10-16(14)15)11-1-4-26-5-2-11/h3,6-7,11,14-16H,1-2,4-5,8-10,22H2,(H,23,25) |
| InChIKey | RUFNPPUWOBIDPE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|