C19H26ClN3O2 — CID 139719699
4-amino-5-chloro-N-[2-[1-(dimethylamino)cyclohexyl]ethyl]-1-benzofuran-7-carboxamide (PubChem CID 139719699) has the molecular formula C19H26ClN3O2 and a molecular weight of 363.89 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[2-[1-(dimethylamino)cyclohexyl]ethyl]-1-benzofuran-7-carboxamide.
| Compound Name | 4-amino-5-chloro-N-[2-[1-(dimethylamino)cyclohexyl]ethyl]-1-benzofuran-7-carboxamide |
|---|---|
| PubChem CID | 139719699 |
| Molecular Formula | C19H26ClN3O2 |
| Molecular Weight | 363.89 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 4-amino-5-chloro-N-[2-[1-(dimethylamino)cyclohexyl]ethyl]-1-benzofuran-7-carboxamide |
| SMILES | CN(C)C1(CCNC(=O)c2cc(Cl)c(N)c3ccoc23)CCCCC1 |
| InChI | InChI=1S/C19H26ClN3O2/c1-23(2)19(7-4-3-5-8-19)9-10-22-18(24)14-12-15(20)16(21)13-6-11-25-17(13)14/h6,11-12H,3-5,7-10,21H2,1-2H3,(H,22,24) |
| InChIKey | MBVKQOYBPGEMAN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.89 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|