C20H32ClN3O3S — CID 9119785
2-chloro-5-(diethylsulfamoyl)-N-[[1-(dimethylamino)cyclohexyl]methyl]benzamide (PubChem CID 9119785) has the molecular formula C20H32ClN3O3S and a molecular weight of 430.01 g/mol. Its IUPAC name is 2-chloro-5-(diethylsulfamoyl)-N-[[1-(dimethylamino)cyclohexyl]methyl]benzamide.
| Compound Name | 2-chloro-5-(diethylsulfamoyl)-N-[[1-(dimethylamino)cyclohexyl]methyl]benzamide |
|---|---|
| PubChem CID | 9119785 |
| Molecular Formula | C20H32ClN3O3S |
| Molecular Weight | 430.01 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 2-chloro-5-(diethylsulfamoyl)-N-[[1-(dimethylamino)cyclohexyl]methyl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Cl)c(C(=O)NCC2(N(C)C)CCCCC2)c1 |
| InChI | InChI=1S/C20H32ClN3O3S/c1-5-24(6-2)28(26,27)16-10-11-18(21)17(14-16)19(25)22-15-20(23(3)4)12-8-7-9-13-20/h10-11,14H,5-9,12-13,15H2,1-4H3,(H,22,25) |
| InChIKey | GHNZKWPRVYSLAJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.01 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |