C19H22N4O3 — CID 134256971
methyl 4-[2-(ethylamino)ethylamino]-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzoate (PubChem CID 134256971) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is methyl 4-[2-(ethylamino)ethylamino]-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzoate.
| Compound Name | methyl 4-[2-(ethylamino)ethylamino]-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzoate |
|---|---|
| PubChem CID | 134256971 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | methyl 4-[2-(ethylamino)ethylamino]-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzoate |
| SMILES | CCNCCNc1ccc(C(=O)OC)c(Oc2cnc3[nH]ccc3c2)c1 |
| InChI | InChI=1S/C19H22N4O3/c1-3-20-8-9-21-14-4-5-16(19(24)25-2)17(11-14)26-15-10-13-6-7-22-18(13)23-12-15/h4-7,10-12,20-21H,3,8-9H2,1-2H3,(H,22,23) |
| InChIKey | OEHICEZQMYGQSC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|