C15H13N2O3P — CID 152853712
methyl 4-phosphanyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzoate (PubChem CID 152853712) has the molecular formula C15H13N2O3P and a molecular weight of 300.25 g/mol. Its IUPAC name is methyl 4-phosphanyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzoate.
| Compound Name | methyl 4-phosphanyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzoate |
|---|---|
| PubChem CID | 152853712 |
| Molecular Formula | C15H13N2O3P |
| Molecular Weight | 300.25 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | methyl 4-phosphanyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzoate |
| SMILES | COC(=O)c1ccc(P)cc1Oc1cnc2[nH]ccc2c1 |
| InChI | InChI=1S/C15H13N2O3P/c1-19-15(18)12-3-2-11(21)7-13(12)20-10-6-9-4-5-16-14(9)17-8-10/h2-8H,21H2,1H3,(H,16,17) |
| InChIKey | TVWLDZSWWXDKFK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.25 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|