C18H17IN4O3 — CID 134446807
4-(4-iodopiperazin-1-yl)-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzoic acid (PubChem CID 134446807) has the molecular formula C18H17IN4O3 and a molecular weight of 464.26 g/mol. Its IUPAC name is 4-(4-iodopiperazin-1-yl)-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzoic acid.
| Compound Name | 4-(4-iodopiperazin-1-yl)-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzoic acid |
|---|---|
| PubChem CID | 134446807 |
| Molecular Formula | C18H17IN4O3 |
| Molecular Weight | 464.26 g/mol |
| Exact Mass | 464.03 |
| IUPAC Name | 4-(4-iodopiperazin-1-yl)-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzoic acid |
| SMILES | O=C(O)c1ccc(N2CCN(I)CC2)cc1Oc1cnc2[nH]ccc2c1 |
| InChI | InChI=1S/C18H17IN4O3/c19-23-7-5-22(6-8-23)13-1-2-15(18(24)25)16(10-13)26-14-9-12-3-4-20-17(12)21-11-14/h1-4,9-11H,5-8H2,(H,20,21)(H,24,25) |
| InChIKey | DEXGWHOYYHSKNZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 81.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.26 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|