C19H22N4O3 — CID 134256832
methoxy-[4-piperazin-1-yl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)phenyl]methanol (PubChem CID 134256832) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is methoxy-[4-piperazin-1-yl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)phenyl]methanol.
| Compound Name | methoxy-[4-piperazin-1-yl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)phenyl]methanol |
|---|---|
| PubChem CID | 134256832 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | methoxy-[4-piperazin-1-yl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)phenyl]methanol |
| SMILES | COC(O)c1ccc(N2CCNCC2)cc1Oc1cnc2[nH]ccc2c1 |
| InChI | InChI=1S/C19H22N4O3/c1-25-19(24)16-3-2-14(23-8-6-20-7-9-23)11-17(16)26-15-10-13-4-5-21-18(13)22-12-15/h2-5,10-12,19-20,24H,6-9H2,1H3,(H,21,22) |
| InChIKey | GOWBIRYDAAIUQS-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 82.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|