C28H33ClN4O3 — CID 155473120
4-[4-[[2-(3-chloropropyl)cyclohexen-1-yl]methyl]piperazin-1-yl]-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzoic acid (PubChem CID 155473120) has the molecular formula C28H33ClN4O3 and a molecular weight of 509.05 g/mol. Its IUPAC name is 4-[4-[[2-(3-chloropropyl)cyclohexen-1-yl]methyl]piperazin-1-yl]-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzoic acid.
| Compound Name | 4-[4-[[2-(3-chloropropyl)cyclohexen-1-yl]methyl]piperazin-1-yl]-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzoic acid |
|---|---|
| PubChem CID | 155473120 |
| Molecular Formula | C28H33ClN4O3 |
| Molecular Weight | 509.05 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | 4-[4-[[2-(3-chloropropyl)cyclohexen-1-yl]methyl]piperazin-1-yl]-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzoic acid |
| SMILES | O=C(O)c1ccc(N2CCN(CC3=C(CCCCl)CCCC3)CC2)cc1Oc1cnc2[nH]ccc2c1 |
| InChI | InChI=1S/C28H33ClN4O3/c29-10-3-6-20-4-1-2-5-22(20)19-32-12-14-33(15-13-32)23-7-8-25(28(34)35)26(17-23)36-24-16-21-9-11-30-27(21)31-18-24/h7-9,11,16-18H,1-6,10,12-15,19H2,(H,30,31)(H,34,35) |
| InChIKey | IQXISDUCZJVXET-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 81.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.05 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|