C33H43BN4O5 — CID 175274810
4-[4-[[4,4-dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexen-1-yl]methyl]piperazin-1-yl]-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzoic acid (PubChem CID 175274810) has the molecular formula C33H43BN4O5 and a molecular weight of 586.54 g/mol. Its IUPAC name is 4-[4-[[4,4-dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexen-1-yl]methyl]piperazin-1-yl]-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzoic acid.
| Compound Name | 4-[4-[[4,4-dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexen-1-yl]methyl]piperazin-1-yl]-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzoic acid |
|---|---|
| PubChem CID | 175274810 |
| Molecular Formula | C33H43BN4O5 |
| Molecular Weight | 586.54 g/mol |
| Exact Mass | 586.33 |
| IUPAC Name | 4-[4-[[4,4-dimethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexen-1-yl]methyl]piperazin-1-yl]-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzoic acid |
| SMILES | CC1(C)CCC(CN2CCN(c3ccc(C(=O)O)c(Oc4cnc5[nH]ccc5c4)c3)CC2)=C(B2OC(C)(C)C(C)(C)O2)C1 |
| InChI | InChI=1S/C33H43BN4O5/c1-31(2)11-9-23(27(19-31)34-42-32(3,4)33(5,6)43-34)21-37-13-15-38(16-14-37)24-7-8-26(30(39)40)28(18-24)41-25-17-22-10-12-35-29(22)36-20-25/h7-8,10,12,17-18,20H,9,11,13-16,19,21H2,1-6H3,(H,35,36)(H,39,40) |
| InChIKey | DXUDILTUZLRRMY-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 100.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.54 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|