C40H50ClN7O5S — CID 167303033
N-[3-amino-4-(oxan-4-ylmethylamino)phenyl]sulfonyl-4-[4-[[2-(3-chloropropyl)cyclohexen-1-yl]methyl]piperazin-1-yl]-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide (PubChem CID 167303033) has the molecular formula C40H50ClN7O5S and a molecular weight of 776.40 g/mol. Its IUPAC name is N-[3-amino-4-(oxan-4-ylmethylamino)phenyl]sulfonyl-4-[4-[[2-(3-chloropropyl)cyclohexen-1-yl]methyl]piperazin-1-yl]-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide.
| Compound Name | N-[3-amino-4-(oxan-4-ylmethylamino)phenyl]sulfonyl-4-[4-[[2-(3-chloropropyl)cyclohexen-1-yl]methyl]piperazin-1-yl]-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide |
|---|---|
| PubChem CID | 167303033 |
| Molecular Formula | C40H50ClN7O5S |
| Molecular Weight | 776.40 g/mol |
| Exact Mass | 775.33 |
| IUPAC Name | N-[3-amino-4-(oxan-4-ylmethylamino)phenyl]sulfonyl-4-[4-[[2-(3-chloropropyl)cyclohexen-1-yl]methyl]piperazin-1-yl]-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide |
| SMILES | Nc1cc(S(=O)(=O)NC(=O)c2ccc(N3CCN(CC4=C(CCCCl)CCCC4)CC3)cc2Oc2cnc3[nH]ccc3c2)ccc1NCC1CCOCC1 |
| InChI | InChI=1S/C40H50ClN7O5S/c41-14-3-6-29-4-1-2-5-31(29)27-47-16-18-48(19-17-47)32-7-9-35(38(23-32)53-33-22-30-11-15-43-39(30)45-26-33)40(49)46-54(50,51)34-8-10-37(36(42)24-34)44-25-28-12-20-52-21-13-28/h7-11,15,22-24,26,28,44H,1-6,12-14,16-21,25,27,42H2,(H,43,45)(H,46,49) |
| InChIKey | KHHUXLZSMSLQHV-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 154.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.40 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|