C17H10Cl3FN2O4 — CID 170553289
methyl 4-fluoro-2-[[3-(2,2,2-trichloroacetyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]oxy]benzoate (PubChem CID 170553289) has the molecular formula C17H10Cl3FN2O4 and a molecular weight of 431.63 g/mol. Its IUPAC name is methyl 4-fluoro-2-[[3-(2,2,2-trichloroacetyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]oxy]benzoate.
| Compound Name | methyl 4-fluoro-2-[[3-(2,2,2-trichloroacetyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]oxy]benzoate |
|---|---|
| PubChem CID | 170553289 |
| Molecular Formula | C17H10Cl3FN2O4 |
| Molecular Weight | 431.63 g/mol |
| Exact Mass | 429.97 |
| IUPAC Name | methyl 4-fluoro-2-[[3-(2,2,2-trichloroacetyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]oxy]benzoate |
| SMILES | COC(=O)c1ccc(F)cc1Oc1cnc2[nH]cc(C(=O)C(Cl)(Cl)Cl)c2c1 |
| InChI | InChI=1S/C17H10Cl3FN2O4/c1-26-16(25)10-3-2-8(21)4-13(10)27-9-5-11-12(14(24)17(18,19)20)7-23-15(11)22-6-9/h2-7H,1H3,(H,22,23) |
| InChIKey | UBXXMAKJRRZCFT-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.63 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|