C22H24FN3O5 — CID 166800026
methyl 4-(4,4-dimethoxypiperidin-1-yl)-2-[(3-fluoro-1H-pyrrolo[2,3-b]pyridin-5-yl)oxy]benzoate (PubChem CID 166800026) has the molecular formula C22H24FN3O5 and a molecular weight of 429.45 g/mol. Its IUPAC name is methyl 4-(4,4-dimethoxypiperidin-1-yl)-2-[(3-fluoro-1H-pyrrolo[2,3-b]pyridin-5-yl)oxy]benzoate.
| Compound Name | methyl 4-(4,4-dimethoxypiperidin-1-yl)-2-[(3-fluoro-1H-pyrrolo[2,3-b]pyridin-5-yl)oxy]benzoate |
|---|---|
| PubChem CID | 166800026 |
| Molecular Formula | C22H24FN3O5 |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | methyl 4-(4,4-dimethoxypiperidin-1-yl)-2-[(3-fluoro-1H-pyrrolo[2,3-b]pyridin-5-yl)oxy]benzoate |
| SMILES | COC(=O)c1ccc(N2CCC(OC)(OC)CC2)cc1Oc1cnc2[nH]cc(F)c2c1 |
| InChI | InChI=1S/C22H24FN3O5/c1-28-21(27)16-5-4-14(26-8-6-22(29-2,30-3)7-9-26)10-19(16)31-15-11-17-18(23)13-25-20(17)24-12-15/h4-5,10-13H,6-9H2,1-3H3,(H,24,25) |
| InChIKey | IDGRTGKCPIXNDR-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|