C7H10N2O2 — CID 134257442
1-ethenyl-2-oxopyrrolidine-3-carboxamide (PubChem CID 134257442) has the molecular formula C7H10N2O2 and a molecular weight of 154.17 g/mol. Its IUPAC name is 1-ethenyl-2-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-ethenyl-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 134257442 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | 1-ethenyl-2-oxopyrrolidine-3-carboxamide |
| SMILES | C=CN1CCC(C(N)=O)C1=O |
| InChI | InChI=1S/C7H10N2O2/c1-2-9-4-3-5(6(8)10)7(9)11/h2,5H,1,3-4H2,(H2,8,10) |
| InChIKey | HXTXSQWNRVTRIU-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|