C33H30Cl2F2O6 — CID 134257584
[(E,1S)-4-chloro-3-(1-chloroethenyl)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]pent-3-enyl] 3-formyl-2-phenylmethoxybenzoate (PubChem CID 134257584) has the molecular formula C33H30Cl2F2O6 and a molecular weight of 631.50 g/mol. Its IUPAC name is [(E,1S)-4-chloro-3-(1-chloroethenyl)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]pent-3-enyl] 3-formyl-2-phenylmethoxybenzoate.
| Compound Name | [(E,1S)-4-chloro-3-(1-chloroethenyl)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]pent-3-enyl] 3-formyl-2-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 134257584 |
| Molecular Formula | C33H30Cl2F2O6 |
| Molecular Weight | 631.50 g/mol |
| Exact Mass | 630.14 |
| IUPAC Name | [(E,1S)-4-chloro-3-(1-chloroethenyl)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]pent-3-enyl] 3-formyl-2-phenylmethoxybenzoate |
| SMILES | C=C(Cl)/C(C[C@H](OC(=O)c1cccc(C=O)c1OCc1ccccc1)c1ccc(OC(F)F)c(OCC2CC2)c1)=C(\C)Cl |
| InChI | InChI=1S/C33H30Cl2F2O6/c1-20(34)27(21(2)35)16-29(24-13-14-28(43-33(36)37)30(15-24)40-18-23-11-12-23)42-32(39)26-10-6-9-25(17-38)31(26)41-19-22-7-4-3-5-8-22/h3-10,13-15,17,23,29,33H,1,11-12,16,18-19H2,2H3/b27-21+/t29-/m0/s1 |
| InChIKey | GHWVQFUSWAJARK-JGDSNHNJSA-N |
| XLogP | 9.02 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.50 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|