C21H24BrNO3 — CID 13425960
3-(4-bromophenyl)-5,7a-ditert-butyl-3aH-1,2-benzoxazole-4,7-dione (PubChem CID 13425960) has the molecular formula C21H24BrNO3 and a molecular weight of 418.33 g/mol. Its IUPAC name is 3-(4-bromophenyl)-5,7a-ditert-butyl-3aH-1,2-benzoxazole-4,7-dione.
| Compound Name | 3-(4-bromophenyl)-5,7a-ditert-butyl-3aH-1,2-benzoxazole-4,7-dione |
|---|---|
| PubChem CID | 13425960 |
| Molecular Formula | C21H24BrNO3 |
| Molecular Weight | 418.33 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | 3-(4-bromophenyl)-5,7a-ditert-butyl-3aH-1,2-benzoxazole-4,7-dione |
| SMILES | CC(C)(C)C1=CC(=O)C2(C(C)(C)C)ON=C(c3ccc(Br)cc3)C2C1=O |
| InChI | InChI=1S/C21H24BrNO3/c1-19(2,3)14-11-15(24)21(20(4,5)6)16(18(14)25)17(23-26-21)12-7-9-13(22)10-8-12/h7-11,16H,1-6H3 |
| InChIKey | QSDMZPPXXCHWDL-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.33 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |