C21H25NO3 — CID 13425958
5,7a-ditert-butyl-3-phenyl-3aH-1,2-benzoxazole-4,7-dione (PubChem CID 13425958) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is 5,7a-ditert-butyl-3-phenyl-3aH-1,2-benzoxazole-4,7-dione.
| Compound Name | 5,7a-ditert-butyl-3-phenyl-3aH-1,2-benzoxazole-4,7-dione |
|---|---|
| PubChem CID | 13425958 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 5,7a-ditert-butyl-3-phenyl-3aH-1,2-benzoxazole-4,7-dione |
| SMILES | CC(C)(C)C1=CC(=O)C2(C(C)(C)C)ON=C(c3ccccc3)C2C1=O |
| InChI | InChI=1S/C21H25NO3/c1-19(2,3)14-12-15(23)21(20(4,5)6)16(18(14)24)17(22-25-21)13-10-8-7-9-11-13/h7-12,16H,1-6H3 |
| InChIKey | WSUPIZNULMSEIC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |