C13H15NO2 — CID 539950
1-(5,5-dimethyl-3-phenyl-4H-1,2-oxazol-4-yl)ethanone (PubChem CID 539950) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is 1-(5,5-dimethyl-3-phenyl-4H-1,2-oxazol-4-yl)ethanone.
| Compound Name | 1-(5,5-dimethyl-3-phenyl-4H-1,2-oxazol-4-yl)ethanone |
|---|---|
| PubChem CID | 539950 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 1-(5,5-dimethyl-3-phenyl-4H-1,2-oxazol-4-yl)ethanone |
| SMILES | CC(=O)C1C(c2ccccc2)=NOC1(C)C |
| InChI | InChI=1S/C13H15NO2/c1-9(15)11-12(14-16-13(11,2)3)10-7-5-4-6-8-10/h4-8,11H,1-3H3 |
| InChIKey | SVAYUVVOLRGJPN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |