C26H47Br3N4O7 — CID 134260809
N-[3-[2-(3-bromopropanoylamino)-3-[3-(3-bromopropanoylamino)propoxy]-2-[3-(3-bromopropanoylamino)propoxymethyl]propoxy]propyl]butanamide (PubChem CID 134260809) has the molecular formula C26H47Br3N4O7 and a molecular weight of 767.39 g/mol. Its IUPAC name is N-[3-[2-(3-bromopropanoylamino)-3-[3-(3-bromopropanoylamino)propoxy]-2-[3-(3-bromopropanoylamino)propoxymethyl]propoxy]propyl]butanamide.
| Compound Name | N-[3-[2-(3-bromopropanoylamino)-3-[3-(3-bromopropanoylamino)propoxy]-2-[3-(3-bromopropanoylamino)propoxymethyl]propoxy]propyl]butanamide |
|---|---|
| PubChem CID | 134260809 |
| Molecular Formula | C26H47Br3N4O7 |
| Molecular Weight | 767.39 g/mol |
| Exact Mass | 764.10 |
| IUPAC Name | N-[3-[2-(3-bromopropanoylamino)-3-[3-(3-bromopropanoylamino)propoxy]-2-[3-(3-bromopropanoylamino)propoxymethyl]propoxy]propyl]butanamide |
| SMILES | CCCC(=O)NCCCOCC(COCCCNC(=O)CCBr)(COCCCNC(=O)CCBr)NC(=O)CCBr |
| InChI | InChI=1S/C26H47Br3N4O7/c1-2-6-22(34)30-13-3-16-38-19-26(33-25(37)9-12-29,20-39-17-4-14-31-23(35)7-10-27)21-40-18-5-15-32-24(36)8-11-28/h2-21H2,1H3,(H,30,34)(H,31,35)(H,32,36)(H,33,37) |
| InChIKey | LOOAFAJKACTCSY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 144.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|