C17H24N4O2S — CID 134260981
7-[3-[(3,5-dimethyl-1,2,4-triazol-4-yl)amino]sulfanylphenyl]heptanoic acid (PubChem CID 134260981) has the molecular formula C17H24N4O2S and a molecular weight of 348.47 g/mol. Its IUPAC name is 7-[3-[(3,5-dimethyl-1,2,4-triazol-4-yl)amino]sulfanylphenyl]heptanoic acid.
| Compound Name | 7-[3-[(3,5-dimethyl-1,2,4-triazol-4-yl)amino]sulfanylphenyl]heptanoic acid |
|---|---|
| PubChem CID | 134260981 |
| Molecular Formula | C17H24N4O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 7-[3-[(3,5-dimethyl-1,2,4-triazol-4-yl)amino]sulfanylphenyl]heptanoic acid |
| SMILES | Cc1nnc(C)n1NSc1cccc(CCCCCCC(=O)O)c1 |
| InChI | InChI=1S/C17H24N4O2S/c1-13-18-19-14(2)21(13)20-24-16-10-7-9-15(12-16)8-5-3-4-6-11-17(22)23/h7,9-10,12,20H,3-6,8,11H2,1-2H3,(H,22,23) |
| InChIKey | TTZBRVMHPUTMLV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|