C18H24N2O2S2 — CID 155000525
7-[3-[(2,4-dimethyl-1,3-thiazol-5-yl)amino]sulfanylphenyl]heptanoic acid (PubChem CID 155000525) has the molecular formula C18H24N2O2S2 and a molecular weight of 364.54 g/mol. Its IUPAC name is 7-[3-[(2,4-dimethyl-1,3-thiazol-5-yl)amino]sulfanylphenyl]heptanoic acid.
| Compound Name | 7-[3-[(2,4-dimethyl-1,3-thiazol-5-yl)amino]sulfanylphenyl]heptanoic acid |
|---|---|
| PubChem CID | 155000525 |
| Molecular Formula | C18H24N2O2S2 |
| Molecular Weight | 364.54 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 7-[3-[(2,4-dimethyl-1,3-thiazol-5-yl)amino]sulfanylphenyl]heptanoic acid |
| SMILES | Cc1nc(C)c(NSc2cccc(CCCCCCC(=O)O)c2)s1 |
| InChI | InChI=1S/C18H24N2O2S2/c1-13-18(23-14(2)19-13)20-24-16-10-7-9-15(12-16)8-5-3-4-6-11-17(21)22/h7,9-10,12,20H,3-6,8,11H2,1-2H3,(H,21,22) |
| InChIKey | YOILSFRFMYADKK-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.54 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|