C28H28N4O3S — CID 163246691
4-[3-[2-[(3-aminophenyl)sulfanylamino]-6-(2,6-dimethylphenyl)pyrimidin-4-yl]oxyphenyl]butanoic acid (PubChem CID 163246691) has the molecular formula C28H28N4O3S and a molecular weight of 500.62 g/mol. Its IUPAC name is 4-[3-[2-[(3-aminophenyl)sulfanylamino]-6-(2,6-dimethylphenyl)pyrimidin-4-yl]oxyphenyl]butanoic acid.
| Compound Name | 4-[3-[2-[(3-aminophenyl)sulfanylamino]-6-(2,6-dimethylphenyl)pyrimidin-4-yl]oxyphenyl]butanoic acid |
|---|---|
| PubChem CID | 163246691 |
| Molecular Formula | C28H28N4O3S |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | 4-[3-[2-[(3-aminophenyl)sulfanylamino]-6-(2,6-dimethylphenyl)pyrimidin-4-yl]oxyphenyl]butanoic acid |
| SMILES | Cc1cccc(C)c1-c1cc(Oc2cccc(CCCC(=O)O)c2)nc(NSc2cccc(N)c2)n1 |
| InChI | InChI=1S/C28H28N4O3S/c1-18-7-3-8-19(2)27(18)24-17-25(31-28(30-24)32-36-23-13-6-11-21(29)16-23)35-22-12-4-9-20(15-22)10-5-14-26(33)34/h3-4,6-9,11-13,15-17H,5,10,14,29H2,1-2H3,(H,33,34)(H,30,31,32) |
| InChIKey | FAZVMBDYRGULOL-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|