C21H29NOS — CID 142285159
6-[3-(2,4,6-trimethylanilino)sulfanylphenyl]hexan-1-ol (PubChem CID 142285159) has the molecular formula C21H29NOS and a molecular weight of 343.54 g/mol. Its IUPAC name is 6-[3-(2,4,6-trimethylanilino)sulfanylphenyl]hexan-1-ol.
| Compound Name | 6-[3-(2,4,6-trimethylanilino)sulfanylphenyl]hexan-1-ol |
|---|---|
| PubChem CID | 142285159 |
| Molecular Formula | C21H29NOS |
| Molecular Weight | 343.54 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | 6-[3-(2,4,6-trimethylanilino)sulfanylphenyl]hexan-1-ol |
| SMILES | Cc1cc(C)c(NSc2cccc(CCCCCCO)c2)c(C)c1 |
| InChI | InChI=1S/C21H29NOS/c1-16-13-17(2)21(18(3)14-16)22-24-20-11-8-10-19(15-20)9-6-4-5-7-12-23/h8,10-11,13-15,22-23H,4-7,9,12H2,1-3H3 |
| InChIKey | USLXQAJURGKSGA-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.54 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|