C28H25ClN2OS — CID 134263542
[4-[5-(2-benzyl-4-pyridinyl)thiophen-3-yl]-3-chlorophenyl]-piperidin-1-ylmethanone (PubChem CID 134263542) has the molecular formula C28H25ClN2OS and a molecular weight of 473.04 g/mol. Its IUPAC name is [4-[5-(2-benzyl-4-pyridinyl)thiophen-3-yl]-3-chlorophenyl]-piperidin-1-ylmethanone.
| Compound Name | [4-[5-(2-benzyl-4-pyridinyl)thiophen-3-yl]-3-chlorophenyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 134263542 |
| Molecular Formula | C28H25ClN2OS |
| Molecular Weight | 473.04 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | [4-[5-(2-benzyl-4-pyridinyl)thiophen-3-yl]-3-chlorophenyl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1ccc(-c2csc(-c3ccnc(Cc4ccccc4)c3)c2)c(Cl)c1)N1CCCCC1 |
| InChI | InChI=1S/C28H25ClN2OS/c29-26-17-22(28(32)31-13-5-2-6-14-31)9-10-25(26)23-18-27(33-19-23)21-11-12-30-24(16-21)15-20-7-3-1-4-8-20/h1,3-4,7-12,16-19H,2,5-6,13-15H2 |
| InChIKey | PLPCRRZHYDTCMI-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.04 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |