C12H18N2 — CID 134263971
1-N'-[(2-ethenylphenyl)methyl]-1-N-methylethane-1,1-diamine (PubChem CID 134263971) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 1-N'-[(2-ethenylphenyl)methyl]-1-N-methylethane-1,1-diamine.
| Compound Name | 1-N'-[(2-ethenylphenyl)methyl]-1-N-methylethane-1,1-diamine |
|---|---|
| PubChem CID | 134263971 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 1-N'-[(2-ethenylphenyl)methyl]-1-N-methylethane-1,1-diamine |
| SMILES | C=Cc1ccccc1CNC(C)NC |
| InChI | InChI=1S/C12H18N2/c1-4-11-7-5-6-8-12(11)9-14-10(2)13-3/h4-8,10,13-14H,1,9H2,2-3H3 |
| InChIKey | KGTOBFQVNHHVQR-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|