C9H6F6N4O3 — CID 134264380
(2,2,2-trifluoroacetyl) 3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboxylate (PubChem CID 134264380) has the molecular formula C9H6F6N4O3 and a molecular weight of 332.16 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboxylate.
| Compound Name | (2,2,2-trifluoroacetyl) 3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboxylate |
|---|---|
| PubChem CID | 134264380 |
| Molecular Formula | C9H6F6N4O3 |
| Molecular Weight | 332.16 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboxylate |
| SMILES | O=C(OC(=O)C(F)(F)F)N1CCn2c(nnc2C(F)(F)F)C1 |
| InChI | InChI=1S/C9H6F6N4O3/c10-8(11,12)5-17-16-4-3-18(1-2-19(4)5)7(21)22-6(20)9(13,14)15/h1-3H2 |
| InChIKey | BWFQZYICUOTTSL-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.16 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|