C29H30ClFN2O4S — CID 134265294
2-[[4-[1-(4-chlorophenyl)-1-(7-fluoro-5-methyl-1H-indol-3-yl)pentan-2-yl]benzoyl]amino]ethanesulfonic acid (PubChem CID 134265294) has the molecular formula C29H30ClFN2O4S and a molecular weight of 557.09 g/mol. Its IUPAC name is 2-[[4-[1-(4-chlorophenyl)-1-(7-fluoro-5-methyl-1H-indol-3-yl)pentan-2-yl]benzoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[4-[1-(4-chlorophenyl)-1-(7-fluoro-5-methyl-1H-indol-3-yl)pentan-2-yl]benzoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 134265294 |
| Molecular Formula | C29H30ClFN2O4S |
| Molecular Weight | 557.09 g/mol |
| Exact Mass | 556.16 |
| IUPAC Name | 2-[[4-[1-(4-chlorophenyl)-1-(7-fluoro-5-methyl-1H-indol-3-yl)pentan-2-yl]benzoyl]amino]ethanesulfonic acid |
| SMILES | CCCC(c1ccc(C(=O)NCCS(=O)(=O)O)cc1)C(c1ccc(Cl)cc1)c1c[nH]c2c(F)cc(C)cc12 |
| InChI | InChI=1S/C29H30ClFN2O4S/c1-3-4-23(19-5-7-21(8-6-19)29(34)32-13-14-38(35,36)37)27(20-9-11-22(30)12-10-20)25-17-33-28-24(25)15-18(2)16-26(28)31/h5-12,15-17,23,27,33H,3-4,13-14H2,1-2H3,(H,32,34)(H,35,36,37) |
| InChIKey | GJMUPVLHXZXWST-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.09 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|