C11H14ClN3 — CID 134265669
(6aR)-4-chloro-6,6a,7,8,9,10-hexahydro-5H-pyrazino[1,2-a][1,8]naphthyridine (PubChem CID 134265669) has the molecular formula C11H14ClN3 and a molecular weight of 223.71 g/mol. Its IUPAC name is (6aR)-4-chloro-6,6a,7,8,9,10-hexahydro-5H-pyrazino[1,2-a][1,8]naphthyridine.
| Compound Name | (6aR)-4-chloro-6,6a,7,8,9,10-hexahydro-5H-pyrazino[1,2-a][1,8]naphthyridine |
|---|---|
| PubChem CID | 134265669 |
| Molecular Formula | C11H14ClN3 |
| Molecular Weight | 223.71 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | (6aR)-4-chloro-6,6a,7,8,9,10-hexahydro-5H-pyrazino[1,2-a][1,8]naphthyridine |
| SMILES | Clc1ccnc2c1CC[C@@H]1CNCCN21 |
| InChI | InChI=1S/C11H14ClN3/c12-10-3-4-14-11-9(10)2-1-8-7-13-5-6-15(8)11/h3-4,8,13H,1-2,5-7H2/t8-/m1/s1 |
| InChIKey | XNITVWNCNFQVDG-MRVPVSSYSA-N |
| XLogP | 1.46 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.71 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |