C7H10N4 — CID 134267974
1-(4-ethenyl-1,2,4-triazol-3-yl)-N-methylethanimine (PubChem CID 134267974) has the molecular formula C7H10N4 and a molecular weight of 150.18 g/mol. Its IUPAC name is 1-(4-ethenyl-1,2,4-triazol-3-yl)-N-methylethanimine.
| Compound Name | 1-(4-ethenyl-1,2,4-triazol-3-yl)-N-methylethanimine |
|---|---|
| PubChem CID | 134267974 |
| Molecular Formula | C7H10N4 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | 1-(4-ethenyl-1,2,4-triazol-3-yl)-N-methylethanimine |
| SMILES | C=Cn1cnnc1/C(C)=N/C |
| InChI | InChI=1S/C7H10N4/c1-4-11-5-9-10-7(11)6(2)8-3/h4-5H,1H2,2-3H3/b8-6+ |
| InChIKey | NXQMGXKSOUTKFQ-SOFGYWHQSA-N |
| XLogP | 0.82 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|