C13H21N — CID 134269156
(2E,4Z)-N-[(3Z)-hexa-3,5-dien-2-yl]-N-methylhexa-2,4-dien-3-amine (PubChem CID 134269156) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is (2E,4Z)-N-[(3Z)-hexa-3,5-dien-2-yl]-N-methylhexa-2,4-dien-3-amine.
| Compound Name | (2E,4Z)-N-[(3Z)-hexa-3,5-dien-2-yl]-N-methylhexa-2,4-dien-3-amine |
|---|---|
| PubChem CID | 134269156 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | (2E,4Z)-N-[(3Z)-hexa-3,5-dien-2-yl]-N-methylhexa-2,4-dien-3-amine |
| SMILES | C=C/C=C\C(C)N(C)C(/C=C\C)=C/C |
| InChI | InChI=1S/C13H21N/c1-6-9-11-12(4)14(5)13(8-3)10-7-2/h6-12H,1H2,2-5H3/b10-7-,11-9-,13-8+ |
| InChIKey | KSNPWPQMNMMSHD-HVYGUOEKSA-N |
| XLogP | 3.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|