C19H15FN4OS — CID 134269481
N-(2-but-3-yn-2-yloxy-4-fluorophenyl)-5-methyl-7-thionitrosoquinazolin-4-amine (PubChem CID 134269481) has the molecular formula C19H15FN4OS and a molecular weight of 366.42 g/mol. Its IUPAC name is N-(2-but-3-yn-2-yloxy-4-fluorophenyl)-5-methyl-7-thionitrosoquinazolin-4-amine.
| Compound Name | N-(2-but-3-yn-2-yloxy-4-fluorophenyl)-5-methyl-7-thionitrosoquinazolin-4-amine |
|---|---|
| PubChem CID | 134269481 |
| Molecular Formula | C19H15FN4OS |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | N-(2-but-3-yn-2-yloxy-4-fluorophenyl)-5-methyl-7-thionitrosoquinazolin-4-amine |
| SMILES | C#CC(C)Oc1cc(F)ccc1Nc1ncnc2cc(N=S)cc(C)c12 |
| InChI | InChI=1S/C19H15FN4OS/c1-4-12(3)25-17-8-13(20)5-6-15(17)23-19-18-11(2)7-14(24-26)9-16(18)21-10-22-19/h1,5-10,12H,2-3H3,(H,21,22,23) |
| InChIKey | JWMLHICBNINERX-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 59.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|