C22H18FN5OS — CID 134269498
N-[4-fluoro-2-(1-pyridin-4-ylethoxy)phenyl]-5-methyl-7-thionitrosoquinazolin-4-amine (PubChem CID 134269498) has the molecular formula C22H18FN5OS and a molecular weight of 419.49 g/mol. Its IUPAC name is N-[4-fluoro-2-(1-pyridin-4-ylethoxy)phenyl]-5-methyl-7-thionitrosoquinazolin-4-amine.
| Compound Name | N-[4-fluoro-2-(1-pyridin-4-ylethoxy)phenyl]-5-methyl-7-thionitrosoquinazolin-4-amine |
|---|---|
| PubChem CID | 134269498 |
| Molecular Formula | C22H18FN5OS |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | N-[4-fluoro-2-(1-pyridin-4-ylethoxy)phenyl]-5-methyl-7-thionitrosoquinazolin-4-amine |
| SMILES | Cc1cc(N=S)cc2ncnc(Nc3ccc(F)cc3OC(C)c3ccncc3)c12 |
| InChI | InChI=1S/C22H18FN5OS/c1-13-9-17(28-30)11-19-21(13)22(26-12-25-19)27-18-4-3-16(23)10-20(18)29-14(2)15-5-7-24-8-6-15/h3-12,14H,1-2H3,(H,25,26,27) |
| InChIKey | NNLDAZLMBCUZCE-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 72.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |