C39H47NO5 — CID 134270879
N-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3,5-dimethylheptan-3-yl]-4-methoxybenzamide (PubChem CID 134270879) has the molecular formula C39H47NO5 and a molecular weight of 609.81 g/mol. Its IUPAC name is N-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3,5-dimethylheptan-3-yl]-4-methoxybenzamide.
| Compound Name | N-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3,5-dimethylheptan-3-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 134270879 |
| Molecular Formula | C39H47NO5 |
| Molecular Weight | 609.81 g/mol |
| Exact Mass | 609.35 |
| IUPAC Name | N-[5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3,5-dimethylheptan-3-yl]-4-methoxybenzamide |
| SMILES | CCC(C)(COC(c1ccccc1)(c1ccc(OC)cc1)c1ccc(OC)cc1)CC(C)(CC)NC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C39H47NO5/c1-8-37(3,27-38(4,9-2)40-36(41)29-15-21-33(42-5)22-16-29)28-45-39(30-13-11-10-12-14-30,31-17-23-34(43-6)24-18-31)32-19-25-35(44-7)26-20-32/h10-26H,8-9,27-28H2,1-7H3,(H,40,41) |
| InChIKey | AUJQMHFPDHFXHX-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.81 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|