C28H22O3 — CID 134271015
3-ethenyl-2-(4-hydroxyphenyl)-1-(3-methylphenyl)-1H-benzo[f]chromen-8-ol (PubChem CID 134271015) has the molecular formula C28H22O3 and a molecular weight of 406.48 g/mol. Its IUPAC name is 3-ethenyl-2-(4-hydroxyphenyl)-1-(3-methylphenyl)-1H-benzo[f]chromen-8-ol.
| Compound Name | 3-ethenyl-2-(4-hydroxyphenyl)-1-(3-methylphenyl)-1H-benzo[f]chromen-8-ol |
|---|---|
| PubChem CID | 134271015 |
| Molecular Formula | C28H22O3 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 3-ethenyl-2-(4-hydroxyphenyl)-1-(3-methylphenyl)-1H-benzo[f]chromen-8-ol |
| SMILES | C=CC1=C(c2ccc(O)cc2)C(c2cccc(C)c2)c2c(ccc3cc(O)ccc23)O1 |
| InChI | InChI=1S/C28H22O3/c1-3-24-26(18-7-10-21(29)11-8-18)27(20-6-4-5-17(2)15-20)28-23-13-12-22(30)16-19(23)9-14-25(28)31-24/h3-16,27,29-30H,1H2,2H3 |
| InChIKey | ISFDHCIXJKXUJP-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |