C21H17NO3 — CID 24805828
3-(8-methyl-3-oxo-1,2-dihydrobenzo[f]chromen-1-yl)benzamide (PubChem CID 24805828) has the molecular formula C21H17NO3 and a molecular weight of 331.37 g/mol. Its IUPAC name is 3-(8-methyl-3-oxo-1,2-dihydrobenzo[f]chromen-1-yl)benzamide.
| Compound Name | 3-(8-methyl-3-oxo-1,2-dihydrobenzo[f]chromen-1-yl)benzamide |
|---|---|
| PubChem CID | 24805828 |
| Molecular Formula | C21H17NO3 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 3-(8-methyl-3-oxo-1,2-dihydrobenzo[f]chromen-1-yl)benzamide |
| SMILES | Cc1ccc2c3c(ccc2c1)OC(=O)CC3c1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C21H17NO3/c1-12-5-7-16-14(9-12)6-8-18-20(16)17(11-19(23)25-18)13-3-2-4-15(10-13)21(22)24/h2-10,17H,11H2,1H3,(H2,22,24) |
| InChIKey | LCCVSUCWEOARCV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|