C51H47N — CID 134271462
1-methyl-2,5-bis(6,6,9,18,18-pentamethyl-3-pentacyclo[12.3.1.05,17.07,16.010,15]octadeca-1(17),2,4,7(16),8,10(15),11,13-octaenyl)pyrrole (PubChem CID 134271462) has the molecular formula C51H47N and a molecular weight of 673.94 g/mol. Its IUPAC name is 1-methyl-2,5-bis(6,6,9,18,18-pentamethyl-3-pentacyclo[12.3.1.05,17.07,16.010,15]octadeca-1(17),2,4,7(16),8,10(15),11,13-octaenyl)pyrrole.
| Compound Name | 1-methyl-2,5-bis(6,6,9,18,18-pentamethyl-3-pentacyclo[12.3.1.05,17.07,16.010,15]octadeca-1(17),2,4,7(16),8,10(15),11,13-octaenyl)pyrrole |
|---|---|
| PubChem CID | 134271462 |
| Molecular Formula | C51H47N |
| Molecular Weight | 673.94 g/mol |
| Exact Mass | 673.37 |
| IUPAC Name | 1-methyl-2,5-bis(6,6,9,18,18-pentamethyl-3-pentacyclo[12.3.1.05,17.07,16.010,15]octadeca-1(17),2,4,7(16),8,10(15),11,13-octaenyl)pyrrole |
| SMILES | Cc1cc2c3c4c(cccc14)C(C)(C)c1cc(-c4ccc(-c5cc6c7c(c5)C(C)(C)c5cccc8c(C)cc(c-7c58)C6(C)C)n4C)cc(c1-3)C2(C)C |
| InChI | InChI=1S/C51H47N/c1-26-20-34-46-42-30(26)14-12-16-32(42)48(3,4)36-22-28(24-38(44(36)46)50(34,7)8)40-18-19-41(52(40)11)29-23-37-45-39(25-29)51(9,10)35-21-27(2)31-15-13-17-33(49(37,5)6)43(31)47(35)45/h12-25H,1-11H3 |
| InChIKey | DPPUWJKJOVCNDE-UHFFFAOYSA-N |
| XLogP | 13.17 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.94 |
| LogP ≤ 5 | 13.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |