C37H30 — CID 140586346
6,6,9,18,18-pentamethyl-3-[2-(4-phenylphenyl)ethynyl]pentacyclo[12.3.1.05,17.07,16.010,15]octadeca-1(17),2,4,7(16),8,10(15),11,13-octaene (PubChem CID 140586346) has the molecular formula C37H30 and a molecular weight of 474.65 g/mol. Its IUPAC name is 6,6,9,18,18-pentamethyl-3-[2-(4-phenylphenyl)ethynyl]pentacyclo[12.3.1.05,17.07,16.010,15]octadeca-1(17),2,4,7(16),8,10(15),11,13-octaene.
| Compound Name | 6,6,9,18,18-pentamethyl-3-[2-(4-phenylphenyl)ethynyl]pentacyclo[12.3.1.05,17.07,16.010,15]octadeca-1(17),2,4,7(16),8,10(15),11,13-octaene |
|---|---|
| PubChem CID | 140586346 |
| Molecular Formula | C37H30 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 6,6,9,18,18-pentamethyl-3-[2-(4-phenylphenyl)ethynyl]pentacyclo[12.3.1.05,17.07,16.010,15]octadeca-1(17),2,4,7(16),8,10(15),11,13-octaene |
| SMILES | Cc1cc2c3c4c(cccc14)C(C)(C)c1cc(C#Cc4ccc(-c5ccccc5)cc4)cc(c1-3)C2(C)C |
| InChI | InChI=1S/C37H30/c1-23-20-30-35-33-28(23)12-9-13-29(33)36(2,3)31-21-25(22-32(34(31)35)37(30,4)5)15-14-24-16-18-27(19-17-24)26-10-7-6-8-11-26/h6-13,16-22H,1-5H3 |
| InChIKey | HYBMZAJSCQLHBH-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|