C22H18N10O8S3 — CID 134273139
1,3-bis(4-azidosulfonylphenyl)propan-2-yl N-(4-azidosulfonylphenyl)carbamate (PubChem CID 134273139) has the molecular formula C22H18N10O8S3 and a molecular weight of 646.65 g/mol. Its IUPAC name is 1,3-bis(4-azidosulfonylphenyl)propan-2-yl N-(4-azidosulfonylphenyl)carbamate.
| Compound Name | 1,3-bis(4-azidosulfonylphenyl)propan-2-yl N-(4-azidosulfonylphenyl)carbamate |
|---|---|
| PubChem CID | 134273139 |
| Molecular Formula | C22H18N10O8S3 |
| Molecular Weight | 646.65 g/mol |
| Exact Mass | 646.05 |
| IUPAC Name | 1,3-bis(4-azidosulfonylphenyl)propan-2-yl N-(4-azidosulfonylphenyl)carbamate |
| SMILES | [N-]=[N+]=NS(=O)(=O)c1ccc(CC(Cc2ccc(S(=O)(=O)N=[N+]=[N-])cc2)OC(=O)Nc2ccc(S(=O)(=O)N=[N+]=[N-])cc2)cc1 |
| InChI | InChI=1S/C22H18N10O8S3/c23-27-30-41(34,35)19-7-1-15(2-8-19)13-18(14-16-3-9-20(10-4-16)42(36,37)31-28-24)40-22(33)26-17-5-11-21(12-6-17)43(38,39)32-29-25/h1-12,18H,13-14H2,(H,26,33) |
| InChIKey | ZFIGGZHPIFHGDG-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 287.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.65 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|