C25H27N5O4S — CID 21428028
1-(4-azidosulfonylphenyl)-3-[(3-benzyl-5-tert-butyl-4-hydroxyphenyl)methyl]urea (PubChem CID 21428028) has the molecular formula C25H27N5O4S and a molecular weight of 493.59 g/mol. Its IUPAC name is 1-(4-azidosulfonylphenyl)-3-[(3-benzyl-5-tert-butyl-4-hydroxyphenyl)methyl]urea.
| Compound Name | 1-(4-azidosulfonylphenyl)-3-[(3-benzyl-5-tert-butyl-4-hydroxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 21428028 |
| Molecular Formula | C25H27N5O4S |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | 1-(4-azidosulfonylphenyl)-3-[(3-benzyl-5-tert-butyl-4-hydroxyphenyl)methyl]urea |
| SMILES | CC(C)(C)c1cc(CNC(=O)Nc2ccc(S(=O)(=O)N=[N+]=[N-])cc2)cc(Cc2ccccc2)c1O |
| InChI | InChI=1S/C25H27N5O4S/c1-25(2,3)22-15-18(14-19(23(22)31)13-17-7-5-4-6-8-17)16-27-24(32)28-20-9-11-21(12-10-20)35(33,34)30-29-26/h4-12,14-15,31H,13,16H2,1-3H3,(H2,27,28,32) |
| InChIKey | ZNZRCXYFUBVMDC-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 144.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|